CAS 7374-80-3
:1,4-Bis(1-chloro-1-methylethyl)benzene
Description:
1,4-Bis(1-chloro-1-methylethyl)benzene, also known as bis(1-chloro-1-methylethyl)benzene, is an organic compound characterized by its structure, which features a benzene ring substituted at the 1 and 4 positions with 1-chloro-1-methylethyl groups. This compound is typically a colorless to pale yellow liquid with a distinct odor. It is classified as a chlorinated aromatic hydrocarbon, which may exhibit properties such as moderate volatility and solubility in organic solvents. The presence of chlorine atoms in its structure contributes to its reactivity and potential applications in various chemical processes, including as an intermediate in the synthesis of other organic compounds. Additionally, due to its chlorinated nature, it may pose environmental and health concerns, necessitating careful handling and disposal. Its physical and chemical properties, such as boiling point, melting point, and density, are influenced by the molecular structure and substituents, making it important for specific applications in industrial chemistry.
Formula:C12H16Cl2
InChI:InChI=1S/C12H16Cl2/c1-11(2,13)9-5-7-10(8-6-9)12(3,4)14/h5-8H,1-4H3
InChI key:InChIKey=GWRGEEAABGHXBR-UHFFFAOYSA-N
SMILES:C(C)(C)(Cl)C1=CC=C(C(C)(C)Cl)C=C1
Synonyms:- 1,4-Bis(α-chloroisopropyl)benzene
- 1,4-Bis(2-chloroisopropyl)benzene
- Benzene, 1,4-bis(1-chloro-1-methylethyl)-
- Benzene, 1,4-bis(1-chloro-1-methylethyl)-
- 1,4-Bis(1-chloro-1-methylethyl)benzene
- Benzene, p-bis(1-chloro-1-methylethyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.