CAS 73742-08-2

(3-Aminophenyl)-2-pyridinylmethanone

Description:

(3-Aminophenyl)-2-pyridinylmethanone, identified by its CAS number 73742-08-2, is an organic compound characterized by the presence of both an amine and a ketone functional group. Structurally, it features a pyridine ring and an aniline moiety, which contribute to its potential biological activity. The compound is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the presence of the amino group, which can engage in hydrogen bonding. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as compounds with similar frameworks often display interesting biological properties, including antimicrobial and anticancer activities. Additionally, the presence of the pyridine ring may enhance its ability to interact with biological targets. As with many organic compounds, safety and handling precautions should be observed, as the specific toxicity and environmental impact of this compound would require further investigation.

Formula: C₁₂H₁₀N₂O

InChI: InChI=1S/C12H10N2O/c13-10-5-3-4-9(8-10)12(15)11-6-1-2-7-14-11/h1-8H,13H2

InChI key: InChIKey=YCDKFSQCLQYJMG-UHFFFAOYSA-N

SMILES: C(=O)(C1=CC(N)=CC=C1)C2=CC=CC=N2

Synonyms:

• Methanone, (3-aminophenyl)-2-pyridinyl-
• 2-(3-Aminobenzoyl)pyridine
• (3-Aminophenyl)-2-pyridinylmethanone