CAS 73742-45-7
:5-Chloro-6-(chloromethyl)pyrimidine-2,4(1H,3H)-dione
Description:
5-Chloro-6-(chloromethyl)pyrimidine-2,4(1H,3H)-dione, with the CAS number 73742-45-7, is a heterocyclic organic compound characterized by a pyrimidine ring substituted with chlorine and chloromethyl groups. This compound features a pyrimidine backbone, which is a six-membered ring containing two nitrogen atoms at positions 1 and 3. The presence of the chloromethyl group at position 6 and a chlorine atom at position 5 enhances its reactivity, making it useful in various synthetic applications, particularly in medicinal chemistry and agrochemicals. The diketone functional groups at positions 2 and 4 contribute to its potential as a versatile building block in organic synthesis. The compound is typically solid at room temperature and may exhibit moderate solubility in polar organic solvents. Its reactivity can be attributed to the electrophilic nature of the chlorinated sites, allowing for further functionalization. Safety precautions should be taken when handling this compound, as it may pose health risks due to its chlorinated nature.
Formula:C5H4Cl2N2O2
InChI:InChI=1/C5H4Cl2N2O2/c6-1-2-3(7)4(10)9-5(11)8-2/h1H2,(H2,8,9,10,11)
SMILES:C(c1c(c(nc(n1)O)O)Cl)Cl
Synonyms:- 2,4(1H,3H)-Pyrimidinedione, 5-chloro-6-(chloromethyl)-
- 5-Chlor-6-chlormethyl-1H-pyrimidin-2,4-dion
- 5-Chloro-6-(chloromethyl)-2,4(1H,3H)-pyrimidinedione
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
2,4(1H,3H)-Pyrimidinedione,5-chloro-6-(chloromethyl)-(9CI)
CAS:Formula:C5H4Cl2N2O2Purity:95%Color and Shape:SolidMolecular weight:195.00355-Chloro-6-(chloromethyl)pyrimidine-2,4(1H,3H)-dione
CAS:5-Chloro-6-(chloromethyl)pyrimidine-2,4(1H,3H)-dionePurity:97%Molecular weight:195.00g/mol5-Chloro-6-(chloromethyl)pyrimidine-2,4(1H,3H)-dione
CAS:Formula:C5H4Cl2N2O2Purity:97%+;RGMolecular weight:1955-Chloro-6-(chloromethyl)pyrimidine-2,4(1H,3H)-dione
CAS:5-Chloro-6-(chloromethyl)pyrimidine-2,4(1H,3H)-dione is a versatile compound that has various applications in different fields. It is commonly used as a metal complex for tracers in research chemicals. This compound is known for its ability to form stable complexes with metals, making it ideal for use in tracing experiments. Additionally, it is widely used in crystallization studies and has been found to be effective in the synthesis of zeolite and selenite crystals.Formula:C5H4Cl2N2O2Purity:Min. 95%Molecular weight:195 g/mol5-Chloro-6-(chloromethyl)pyrimidine-2,4(1H,3H)-dione
CAS:5-Chloro-6-(chloromethyl)pyrimidine-2,4(1H,3H)-dione is a useful organic compound for research related to life sciences. The catalog number is T66943 and the CAS number is 73742-45-7.Formula:C5H4Cl2N2O2Color and Shape:SolidMolecular weight:195.0




