CAS 73742-63-9
:4-Mercapto-3-pyridinesulfonamide
Description:
4-Mercapto-3-pyridinesulfonamide is a chemical compound characterized by its unique structure, which includes a pyridine ring, a sulfonamide group, and a thiol (-SH) functional group. This compound is typically a solid at room temperature and is soluble in polar solvents due to the presence of the sulfonamide group, which enhances its hydrophilicity. The thiol group imparts reactivity, allowing it to participate in various chemical reactions, such as nucleophilic substitutions and redox reactions. 4-Mercapto-3-pyridinesulfonamide may exhibit biological activity, making it of interest in pharmaceutical research, particularly in the development of antimicrobial or antitumor agents. Its properties can be influenced by factors such as pH and the presence of other functional groups in a given environment. Safety data should be consulted for handling and usage, as compounds containing thiol groups can be sensitive to oxidation and may have specific toxicity profiles. Overall, this compound represents a versatile building block in organic synthesis and medicinal chemistry.
Formula:C5H6N2O2S2
InChI:InChI=1/C5H6N2O2S2/c6-11(8,9)5-3-7-2-1-4(5)10/h1-3H,(H,7,10)(H2,6,8,9)
SMILES:c1c[nH]cc(c1=S)S(=O)(=O)N
Synonyms:- 4-Thioxo-1,4-Dihydropyridine-3-Sulfonamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
