CAS 73747-26-9
:2-benzyl-3-oxo-2-phenylbutanenitrile
Description:
2-benzyl-3-oxo-2-phenylbutanenitrile, with the CAS number 73747-26-9, is an organic compound characterized by its complex structure, which includes a nitrile functional group, a ketone, and multiple aromatic rings. This compound typically exhibits a white to light yellow crystalline appearance. It is soluble in organic solvents such as ethanol and acetone but has limited solubility in water due to its hydrophobic aromatic components. The presence of the nitrile group contributes to its reactivity, making it a potential candidate for various chemical reactions, including nucleophilic additions. Additionally, the compound may exhibit biological activity, which can be of interest in pharmaceutical research. Its melting point and boiling point can vary based on purity and specific conditions. As with many organic compounds, proper handling and storage are essential to maintain stability and prevent degradation. Overall, 2-benzyl-3-oxo-2-phenylbutanenitrile is a noteworthy compound in organic synthesis and medicinal chemistry.
Formula:C17H15NO
InChI:InChI=1/C17H15NO/c1-14(19)17(13-18,16-10-6-3-7-11-16)12-15-8-4-2-5-9-15/h2-11H,12H2,1H3
SMILES:CC(=O)C(Cc1ccccc1)(C#N)c1ccccc1
Synonyms:- Benzenepropanenitrile, Alpha-Acetyl-Alpha-Phenyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.