CymitQuimica logo

CAS 73749-80-1

:

(diethylamino)[bis(dimethylamino)]methylium chloride

Description:
(Diethylamino)[bis(dimethylamino)]methylium chloride, with the CAS number 73749-80-1, is a quaternary ammonium compound characterized by its complex structure featuring a central carbon atom bonded to two diethylamino groups and two dimethylamino groups, along with a chloride ion. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its form and purity. It is known for its high solubility in polar solvents, such as water and alcohols, due to the presence of the quaternary ammonium moiety, which enhances its ionic character. The presence of multiple amino groups contributes to its potential as a surfactant or in applications involving ion exchange. Additionally, it may exhibit biological activity, making it of interest in medicinal chemistry. However, safety precautions should be observed when handling this compound, as quaternary ammonium compounds can be irritants and may pose environmental hazards. Overall, its unique structure and properties make it a subject of interest in various chemical and industrial applications.
Formula:C9H23ClN3
InChI:InChI=1/C9H22N3.ClH/c1-7-12(8-2)9(10(3)4)11(5)6;/h7-8H2,1-6H3;1H/q+1;/p-1
Synonyms:
  • Methylium, (Diethylamino)Bis(Dimethylamino)-, Chloride (1:1)
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.