CymitQuimica logo

CAS 7375-15-7

:

1-(3-Dimethylaminopropyl)-2-pyrrolidone

Description:
1-(3-Dimethylaminopropyl)-2-pyrrolidone, commonly referred to as DMAP, is a chemical compound characterized by its structure, which includes a pyrrolidone ring and a dimethylaminopropyl side chain. This substance is a colorless to pale yellow liquid at room temperature and is known for its high solubility in water and organic solvents, making it versatile in various applications. DMAP is primarily utilized as a reagent in organic synthesis, particularly in acylation reactions, due to its ability to act as a nucleophilic catalyst. It exhibits moderate toxicity and should be handled with care, following appropriate safety protocols. The compound has a relatively high boiling point and a low vapor pressure, indicating stability under standard conditions. Additionally, DMAP can participate in hydrogen bonding due to the presence of the nitrogen atom in its structure, which can influence its reactivity and interactions with other chemical species. Overall, DMAP is valued in the field of organic chemistry for its effectiveness in facilitating various chemical transformations.
Formula:C9H18N2O
InChI:InChI=1S/C9H18N2O/c1-10(2)6-4-8-11-7-3-5-9(11)12/h3-8H2,1-2H3
InChI key:InChIKey=VBRBLUHWCNINSZ-UHFFFAOYSA-N
SMILES:C(CCN(C)C)N1C(=O)CCC1
Synonyms:
  • 2-Pyrrolidinone, 1-[3-(dimethylamino)propyl]-
  • 1-[3-(Dimethylamino)propyl]-2-pyrrolidinone
  • 1-(3-Dimethylaminopropyl)-2-pyrrolidone
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.