CAS 7375-45-3

N-benzylpyrazin-2-amine

Description:

N-benzylpyrazin-2-amine is an organic compound characterized by its pyrazine ring structure, which is a six-membered aromatic ring containing two nitrogen atoms at the 1 and 4 positions. This compound features a benzyl group attached to the nitrogen atom at the 2-position of the pyrazine ring, contributing to its unique chemical properties. It is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. N-benzylpyrazin-2-amine can participate in various chemical reactions due to the presence of both the amine and aromatic functionalities, making it a potential candidate for applications in pharmaceuticals and organic synthesis. Its properties, such as melting point, boiling point, and reactivity, can vary based on the specific conditions and purity of the sample. As with many nitrogen-containing heterocycles, it may also exhibit biological activity, which could be of interest in medicinal chemistry. Safety data should be consulted for handling and usage, as with any chemical substance.

Formula: C₁₁H₁₁N₃

InChI: InChI=1/C11H11N3/c1-2-4-10(5-3-1)8-14-11-9-12-6-7-13-11/h1-7,9H,8H2,(H,13,14)