CAS 7376-31-0
:Triethanolamine sulfate
Description:
Triethanolamine sulfate, with the CAS number 7376-31-0, is an organic compound that serves as a surfactant and emulsifying agent in various applications. It is derived from triethanolamine, a tri-functional amine, which is reacted with sulfuric acid to form the sulfate salt. This compound is typically a viscous liquid or a solid, depending on its concentration and formulation. Triethanolamine sulfate is known for its ability to enhance the solubility of other substances, making it valuable in cosmetic and personal care products, as well as in industrial formulations. It exhibits good wetting and foaming properties, which contribute to its effectiveness in cleaning products and detergents. Additionally, it is generally considered to be mild and non-irritating, making it suitable for use in formulations intended for sensitive skin. However, like many chemical substances, it should be handled with care, and safety data sheets should be consulted for proper handling and potential hazards.
Formula:C6H15NO3·xH2O4S
InChI:InChI=1S/C6H15NO3.H2O4S/c8-4-1-7(2-5-9)3-6-10;1-5(2,3)4/h8-10H,1-6H2;(H2,1,2,3,4)
InChI key:InChIKey=RZRILSWMGXWSJY-UHFFFAOYSA-N
SMILES:S(=O)(=O)(O)O.N(CCO)(CCO)CCO
Synonyms:- 2,2',2''-Nitrilotris(ethanol) sulfate (salt)
- Ethanol, 2,2',2''-nitrilotris-, sulfate (1:?)
- Ethanol, 2,2',2''-nitrilotris-, sulfate (salt)
- Ethanol, 2,2′,2′′-nitrilotri-, sulfate (salt)
- Ethanol, 2,2′,2′′-nitrilotris-, sulfate (1:?)
- Ethanol, 2,2′,2′′-nitrilotris-, sulfate (salt)
- TEA-Sulfate
- Triethanolamine sulfate
- Triethanolamine sulfuric acid salt
- Triethanolammonium sulfate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
Triethanolamine sulfate
CAS:Controlled ProductTriethanolamine sulfate is a triethanolamine salt of sulfuric acid. It is used to neutralize the pH of reaction solutions in laboratory experiments. The addition of sodium citrate to the solution minimizes the formation of precipitates and improves the stability of the triethanolamine sulfate. Triethanolamine sulfate reacts with water vapor to form an acid, which can be analyzed by electrochemical impedance spectroscopy (EIS). This method can be used to measure the activity index for triethanolamine sulfate in wastewater treatment applications.
Formula:C6H17NO7SPurity:Min. 95%Color and Shape:Clear LiquidMolecular weight:247.27 g/mol
