
CAS 7376-52-5
:1,5-Dihydroxy-4,8-bis[[4-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]phenyl]amino]-9,10-anthracenedione
Description:
1,5-Dihydroxy-4,8-bis[[4-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]phenyl]amino]-9,10-anthracenedione, with CAS number 7376-52-5, is a synthetic organic compound characterized by its complex structure, which includes an anthraquinone core substituted with multiple hydroxyl and ether groups. This compound exhibits significant solubility in organic solvents due to its hydrophobic anthracene backbone, while the hydrophilic ether and hydroxyl groups enhance its interaction with polar solvents. It is primarily recognized for its potential applications in dye chemistry, particularly in the development of fluorescent dyes and pigments. The presence of multiple functional groups allows for various chemical modifications, making it versatile in organic synthesis. Additionally, its unique electronic properties may contribute to its utility in photonic and electronic materials. Safety and handling precautions should be observed, as with many organic compounds, due to potential toxicity and environmental impact. Overall, this compound represents a fascinating intersection of organic chemistry and materials science.
Formula:C38H42N2O12
InChI:InChI=1S/C38H42N2O12/c41-13-15-47-17-19-49-21-23-51-27-5-1-25(2-6-27)39-29-9-11-31(43)35-33(29)37(45)36-32(44)12-10-30(34(36)38(35)46)40-26-3-7-28(8-4-26)52-24-22-50-20-18-48-16-14-42/h1-12,39-44H,13-24H2
InChI key:InChIKey=CSTONOUGGVBVQC-UHFFFAOYSA-N
SMILES:N(C1=C2C(C(=O)C=3C(C2=O)=C(O)C=CC3NC4=CC=C(OCCOCCOCCO)C=C4)=C(O)C=C1)C5=CC=C(OCCOCCOCCO)C=C5
Synonyms:- Anthraquinone, 1,5-dihydroxy-4,8-bis[β-[2-(2-hydroxyethoxy)ethoxy]-p-phenetidino]-
- 9,10-Anthracenedione, 1,5-dihydroxy-4,8-bis[[4-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]phenyl]amino]-
- 1,5-Dihydroxy-4,8-bis[[4-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]phenyl]amino]-9,10-anthracenedione
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
4-(2-(ethylamino)propyl)-1,2-benzenediol hydrobromide
CAS:Formula:C11H18BrNO2Molecular weight:276.1701
