CAS 73761-81-6
:2-Eicosyl-1-tetracosanol
Description:
2-Eicosyl-1-tetracosanol, with the CAS number 73761-81-6, is a long-chain fatty alcohol characterized by its long hydrocarbon chain, which contributes to its hydrophobic properties. This compound features a 20-carbon eicosyl group attached to a tetracosanol backbone, resulting in a total of 24 carbon atoms. It is typically a waxy solid at room temperature and is insoluble in water due to its nonpolar nature, but it is soluble in organic solvents such as ethanol and chloroform. The presence of hydroxyl (-OH) groups in its structure imparts some degree of polarity, allowing for potential interactions with other polar substances. 2-Eicosyl-1-tetracosanol is often used in various applications, including cosmetics and personal care products, due to its emollient properties, which help to moisturize and soften the skin. Additionally, it may serve as a surfactant or emulsifier in formulations. Its stability and resistance to oxidation make it suitable for use in formulations requiring a longer shelf life.
Formula:C44H90O
InChI:InChI=1S/C44H90O/c1-3-5-7-9-11-13-15-17-19-21-23-24-26-28-30-32-34-36-38-40-42-44(43-45)41-39-37-35-33-31-29-27-25-22-20-18-16-14-12-10-8-6-4-2/h44-45H,3-43H2,1-2H3
InChI key:InChIKey=JSIOIMBOKALMPC-UHFFFAOYSA-N
SMILES:C(CCCCCCCCCCCCCCCCCCCCCC)(CCCCCCCCCCCCCCCCCCCC)CO
Synonyms:- 1-Tetracosanol, 2-eicosyl-
- 2-Eicosyl-1-tetracosanol
- 2-Icosyltetracosan-1-Ol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
2-Eicosyl-1-tetracosanol
CAS:Controlled ProductFormula:C44H90OColor and Shape:NeatMolecular weight:635.185
