CymitQuimica logo

CAS 73768-68-0

:

4-[(2,4-dinitrophenyl)sulfanyl]pyrimidine

Description:
4-[(2,4-Dinitrophenyl)sulfanyl]pyrimidine is a chemical compound characterized by its pyrimidine core, which is a six-membered heterocyclic ring containing two nitrogen atoms at positions 1 and 3. The presence of a sulfanyl group (-S-) linked to a 2,4-dinitrophenyl moiety introduces significant reactivity and polarity to the molecule. This compound is typically used in various chemical syntheses and may serve as an intermediate in the production of pharmaceuticals or agrochemicals. The dinitrophenyl group is known for its electron-withdrawing properties, which can enhance the electrophilicity of the pyrimidine ring, making it a useful building block in organic synthesis. Additionally, the compound may exhibit biological activity, although specific applications would depend on further research into its pharmacological properties. Safety data should be consulted due to the presence of the dinitro group, which can be hazardous. Overall, 4-[(2,4-dinitrophenyl)sulfanyl]pyrimidine is a versatile compound with potential applications in various fields of chemistry.
Formula:C10H6N4O4S
InChI:InChI=1/C10H6N4O4S/c15-13(16)7-1-2-9(8(5-7)14(17)18)19-10-3-4-11-6-12-10/h1-6H
Synonyms:
  • Pyrimidine, 4-[(2,4-dinitrophenyl)thio]-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
  • NSC-311068

    CAS:
    <p>NSC-311068: A selective TET1 inhibitor, reducing 5hmC and AML cell viability with high TET1.</p>
    Formula:C10H6N4O4S
    Color and Shape:Solid
    Molecular weight:278.24