CAS 73768-73-7

5-[(3-nitropyridin-2-yl)sulfanyl]-1,3,4-thiadiazole-2(3H)-thione

Description:

5-[(3-Nitropyridin-2-yl)sulfanyl]-1,3,4-thiadiazole-2(3H)-thione is a heterocyclic compound characterized by the presence of a thiadiazole ring, which is a five-membered ring containing both sulfur and nitrogen atoms. This compound features a nitropyridine moiety, contributing to its potential biological activity and chemical reactivity. The thioketone functional group (thione) in the thiadiazole structure enhances its properties, making it a subject of interest in medicinal chemistry and material science. The presence of the nitro group can influence the compound's electronic properties and solubility, while the sulfanyl group may participate in various chemical reactions, including nucleophilic substitutions. This compound may exhibit antimicrobial, antifungal, or anticancer activities, which are common for thiadiazole derivatives. Its unique structural features and functional groups make it a valuable candidate for further research in drug development and synthetic chemistry. As with many heterocycles, its stability and reactivity can be influenced by environmental conditions such as pH and temperature.

Formula: C₇H₄N₄O₂S₃

InChI: InChI=1/C7H4N4O2S3/c12-11(13)4-2-1-3-8-5(4)15-7-10-9-6(14)16-7/h1-3H,(H,9,14)