CAS 737690-96-9
:(5-(pyridin-4-yl)-1,3,4-oxadiazol-2-yl)methanamine
Description:
The chemical substance known as (5-(pyridin-4-yl)-1,3,4-oxadiazol-2-yl)methanamine, with the CAS number 737690-96-9, is characterized by its unique structural features that include a pyridine ring and an oxadiazole moiety. This compound typically exhibits properties such as moderate solubility in polar solvents, which is influenced by the presence of both the pyridine and oxadiazole functional groups. The oxadiazole ring contributes to its potential as a bioactive molecule, often associated with various biological activities, including antimicrobial and anticancer properties. The amine group in the methanamine portion can participate in hydrogen bonding, enhancing its reactivity and interaction with biological targets. Additionally, the compound may exhibit fluorescence properties, making it useful in certain analytical applications. Overall, its structural complexity and functional groups suggest potential utility in medicinal chemistry and material science, although specific applications would depend on further research and characterization.
Formula:C8H8N4O
InChI:InChI=1/C8H8N4O/c9-4-7-11-12-8(13-7)6-2-1-3-10-5-6/h1-3,5H,4,9H2
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
