CAS 7377-73-3
:(4α,5α)-4-Methylcholesta-8,24-dien-3-one
Description:
(4α,5α)-4-Methylcholesta-8,24-dien-3-one, with the CAS number 7377-73-3, is a steroidal compound characterized by its unique structural features, including a methyl group at the 4-position and a ketone functional group at the 3-position of the cholestane backbone. This compound exhibits a complex polycyclic structure typical of steroids, which contributes to its biological activity. It is known to be involved in various biochemical pathways and may serve as a precursor or intermediate in the synthesis of other steroid derivatives. The presence of double bonds in the 8 and 24 positions indicates potential reactivity and influences its physical properties, such as solubility and stability. Additionally, its stereochemistry plays a crucial role in determining its interactions with biological targets, making it of interest in pharmacological research. Overall, (4α,5α)-4-Methylcholesta-8,24-dien-3-one is significant in the study of steroid chemistry and its applications in medicinal chemistry.
Formula:C28H44O
InChI:InChI=1S/C28H44O/c1-18(2)8-7-9-19(3)22-12-13-24-21-10-11-23-20(4)26(29)15-17-28(23,6)25(21)14-16-27(22,24)5/h8,19-20,22-24H,7,9-17H2,1-6H3/t19-,20+,22-,23+,24+,27-,28+/m1/s1
InChI key:InChIKey=DBPZYKHQDWKORQ-SINUOACOSA-N
SMILES:C[C@@]12C3=C([C@]4([C@](C)(CC3)[C@@]([C@@H](CCC=C(C)C)C)(CC4)[H])[H])CC[C@]1([C@H](C)C(=O)CC2)[H]
Synonyms:- 5α-Cholesta-8,24-dien-3-one, 4α-methyl-
- Cholesta-8,24-dien-3-one, 4-methyl-, (4α,5α)-
- (4α,5α)-4-Methylcholesta-8,24-dien-3-one
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
4α-Methyl-5α-cholesta-8,24-dien-3-one
CAS:Controlled ProductFormula:C28H44OColor and Shape:NeatMolecular weight:396.648
