CAS 73771-19-4
:4-methylpiperidine-1-carboximidamide
Description:
4-Methylpiperidine-1-carboximidamide is an organic compound characterized by its piperidine ring structure, which features a methyl group at the fourth position and a carboximidamide functional group at the first position. This compound is typically a colorless to pale yellow liquid or solid, depending on its purity and form. It is soluble in polar solvents, such as water and alcohols, due to the presence of the carboximidamide group, which can engage in hydrogen bonding. The compound is of interest in various fields, including medicinal chemistry, where it may serve as a building block for the synthesis of pharmaceuticals or as a potential bioactive agent. Its reactivity is influenced by the presence of the carboximidamide group, which can participate in nucleophilic reactions. Safety data should be consulted for handling, as with any chemical substance, to ensure proper precautions are taken. Overall, 4-methylpiperidine-1-carboximidamide is a versatile compound with potential applications in chemical synthesis and drug development.
Formula:C7H15N3
InChI:InChI=1/C7H15N3/c1-6-2-4-10(5-3-6)7(8)9/h6H,2-5H2,1H3,(H3,8,9)
SMILES:CC1CCN(CC1)C(=N)N
Synonyms:- 1-Piperidinecarboximidamide, 4-Methyl-
- 4-Methylpiperidine-1-carboximidamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.