CAS 737713-28-9

(1R)-1-(3,5-dimethylphenyl)ethanamine

Description:

(1R)-1-(3,5-dimethylphenyl)ethanamine, also known as a substituted phenethylamine, is an organic compound characterized by its amine functional group attached to a chiral carbon. This compound features a phenyl ring with two methyl groups at the 3 and 5 positions, contributing to its steric and electronic properties. The presence of the amine group suggests potential basicity and reactivity, particularly in forming salts with acids. Its chiral nature indicates that it can exist in two enantiomeric forms, with the (1R) configuration being one specific stereoisomer. This compound may exhibit biological activity, potentially interacting with neurotransmitter systems, which is common among phenethylamines. Its applications could range from research in pharmacology to potential use in the synthesis of more complex molecules. Safety and handling considerations are important, as with many amines, due to their potential toxicity and reactivity. Overall, (1R)-1-(3,5-dimethylphenyl)ethanamine is a compound of interest in both synthetic and medicinal chemistry contexts.

Formula: C₁₀H₁₅N

InChI: InChI=1/C10H15N/c1-7-4-8(2)6-10(5-7)9(3)11/h4-6,9H,11H2,1-3H3/t9-/m1/s1

SMILES: Cc1cc(C)cc(c1)[C@@H](C)N

[(R)-1-(3,5-Dimethylphenyl)ethyl]amine

CAS: 737713-28-9

Formula: C₁₀H₁₅N

Purity: 95%

Color and Shape: Liquid

Molecular weight: 149.2328

Ref: IN-DA00FA67

(1R)-1-(3,5-Dimethylphenyl)ethylaminehydrochloride

CAS: 737713-28-9

Formula: C₁₀H₁₆ClN

Purity: 95.0%

Molecular weight: 185.7

Ref: 10-F209967