
CAS 737713-33-6
:N1-(Phenylmethoxy)-1,4-butanediamine
Description:
N1-(Phenylmethoxy)-1,4-butanediamine, identified by its CAS number 737713-33-6, is an organic compound characterized by its amine functional groups and a phenylmethoxy substituent. This compound features a butanediamine backbone, which consists of two amine (-NH2) groups separated by a four-carbon chain. The presence of the phenylmethoxy group enhances its chemical properties, potentially influencing its solubility, reactivity, and biological activity. Typically, compounds of this nature may exhibit properties such as moderate polarity due to the amine groups, and they may participate in hydrogen bonding, which can affect their interaction with other molecules. The phenylmethoxy moiety can also contribute to the compound's stability and may play a role in its pharmacological profile if applicable. Overall, N1-(Phenylmethoxy)-1,4-butanediamine is of interest in various fields, including medicinal chemistry and materials science, due to its unique structural features and potential applications.
Formula:C11H18N2O
InChI:InChI=1S/C11H18N2O/c12-8-4-5-9-13-14-10-11-6-2-1-3-7-11/h1-3,6-7,13H,4-5,8-10,12H2
InChI key:InChIKey=VEGOOVMQKQHART-UHFFFAOYSA-N
SMILES:C(ONCCCCN)C1=CC=CC=C1
Synonyms:- 1,4-Butanediamine, N1-(phenylmethoxy)-
- (4-Aminobutyl)(benzyloxy)amine
- N1-(Phenylmethoxy)-1,4-butanediamine
- 1,4-Butanediamine, N-(phenylmethoxy)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.