CAS 73772-45-9

N-(Carboxymethyl)-N,N-dimethyl-3-[(1-oxodecyl)amino]-1-popanaminium inner salt

Description:

N-(Carboxymethyl)-N,N-dimethyl-3-[(1-oxodecyl)amino]-1-propanaminium inner salt, with the CAS number 73772-45-9, is a quaternary ammonium compound characterized by its cationic nature due to the presence of a positively charged nitrogen atom. This compound features a carboxymethyl group, which contributes to its solubility in water and potential for forming ionic interactions. The presence of a long-chain alkyl group (decyl) enhances its hydrophobic characteristics, making it suitable for applications in surfactants and emulsifiers. Its dimethylamino groups provide additional stability and reactivity, allowing it to interact with various biological systems. This compound may exhibit antimicrobial properties, making it useful in pharmaceutical and cosmetic formulations. Additionally, its inner salt form indicates that it exists as a zwitterion, which can influence its behavior in different pH environments. Overall, this compound's unique structure and properties make it valuable in various industrial and research applications.

Formula: C₁₇H₃₄N₂O₃

InChI: InChI=1S/C17H34N2O3/c1-4-5-6-7-8-9-10-12-16(20)18-13-11-14-19(2,3)15-17(21)22/h4-15H2,1-3H3,(H-,18,20,21,22)

InChI key: InChIKey=FPVJYHHGNGJAPC-UHFFFAOYSA-N

SMILES: [N+](CCCNC(CCCCCCCCC)=O)(CC([O-])=O)(C)C

Synonyms:

• 1-Propanaminium, N-(carboxymethyl)-N,N-dimethyl-3-((1-oxodecyl)amino)-, hydroxide, inner salt
• 1-Propanaminium, N-(carboxymethyl)-N,N-dimethyl-3-((1-oxodecyl)amino)-, inner salt
• N-(Carboxymethyl)-N,N-dimethyl-3-[(1-oxodecyl)amino]-1-popanaminium inner salt
• {[3-(Decanoylamino)Propyl](Dimethyl)Ammonio}Acetate
• (Carboxymethyl)dimethyl-3-((1-oxodecyl)amino)propylammonium hydroxide