CAS 737754-28-8

2-Hydroxy-5-[(1E)-2-[4-[(2-pyridinylamino)sulfonyl]phenyl]diazenyl]benzoic acid

Description:

2-Hydroxy-5-[(1E)-2-[4-[(2-pyridinylamino)sulfonyl]phenyl]diazenyl]benzoic acid, with CAS number 737754-28-8, is a synthetic organic compound characterized by its complex structure, which includes a hydroxyl group, a diazenyl moiety, and a sulfonamide group. This compound typically exhibits properties associated with azo dyes, such as vibrant coloration and potential applications in dyeing and biological assays. The presence of the pyridinylamino and sulfonyl groups suggests that it may have specific interactions with biological targets, potentially making it useful in medicinal chemistry or as a probe in biochemical studies. Its solubility and stability can vary depending on the pH and solvent conditions, which is crucial for its application in various fields. Additionally, the compound's ability to form hydrogen bonds due to the hydroxyl group may influence its reactivity and interactions with other molecules. Overall, this compound represents a class of azo compounds with potential utility in both industrial and research applications.

Formula: C₁₈H₁₄N₄O₅S

InChI: InChI=1S/C18H14N4O5S/c23-16-9-6-13(11-15(16)18(24)25)21-20-12-4-7-14(8-5-12)28(26,27)22-17-3-1-2-10-19-17/h1-11,23H,(H,19,22)(H,24,25)/b21-20+

InChI key: InChIKey=NCEXYHBECQHGNR-QZQOTICOSA-N

SMILES: S(NC1=CC=CC=N1)(=O)(=O)C2=CC=C(/N=N/C3=CC(C(O)=O)=C(O)C=C3)C=C2

Synonyms:

• 2-Hydroxy-5-[(1E)-2-[4-[(2-pyridinylamino)sulfonyl]phenyl]diazenyl]benzoic acid
• Benzoic acid, 2-hydroxy-5-[(1E)-2-[4-[(2-pyridinylamino)sulfonyl]phenyl]diazenyl]-
• Benzoic acid, 2-hydroxy-5-[(1E)-[4-[(2-pyridinylamino)sulfonyl]phenyl]azo]-