CAS 737758-35-9
:5-Isopropyl-2-methylbenzene-1-sulfonyl chloride
Description:
5-Isopropyl-2-methylbenzene-1-sulfonyl chloride, also known as a sulfonyl chloride compound, is characterized by the presence of a sulfonyl group (-SO2Cl) attached to a substituted aromatic ring. The structure features an isopropyl group and a methyl group on the benzene ring, contributing to its hydrophobic nature and potential steric hindrance. This compound is typically a colorless to pale yellow liquid or solid, depending on its form and purity. It is reactive, particularly with nucleophiles, making it useful in organic synthesis for the introduction of sulfonyl groups into various substrates. The sulfonyl chloride functional group is known for its ability to form sulfonamides and other derivatives, which are valuable in pharmaceuticals and agrochemicals. Additionally, this compound may exhibit moderate to high toxicity, necessitating careful handling and appropriate safety measures during use. Its applications can extend to the synthesis of complex organic molecules, highlighting its significance in chemical research and industrial processes.
Formula:C10H13ClO2S
InChI:InChI=1/C10H13ClO2S/c1-7(2)9-5-4-8(3)10(6-9)14(11,12)13/h4-7H,1-3H3
SMILES:CC(C)c1ccc(C)c(c1)S(=O)(=O)Cl
Synonyms:- p-Cymene-2-sulfonic chloride
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.