
CAS 73776-19-9
:Methyl 1,2-dihydro-4-hydroxy-2-oxo-3-quinolinecarboxylate
Description:
Methyl 1,2-dihydro-4-hydroxy-2-oxo-3-quinolinecarboxylate, with the CAS number 73776-19-9, is a chemical compound that belongs to the class of quinoline derivatives. This substance typically exhibits a complex molecular structure characterized by a quinoline ring fused with a carboxylate group and a hydroxyl group, contributing to its potential biological activity. It is often recognized for its role in medicinal chemistry, particularly in the development of pharmaceuticals due to its ability to interact with various biological targets. The presence of the methyl ester group enhances its solubility and bioavailability, making it a candidate for further research in drug formulation. Additionally, the compound may exhibit antioxidant and anti-inflammatory properties, which are of interest in therapeutic applications. As with many organic compounds, its stability, reactivity, and solubility can vary based on environmental conditions and the presence of other substances. Proper handling and storage are essential to maintain its integrity for research and application purposes.
Formula:C11H9NO4
InChI:InChI=1S/C11H9NO4/c1-16-11(15)8-9(13)6-4-2-3-5-7(6)12-10(8)14/h2-5H,1H3,(H2,12,13,14)
InChI key:InChIKey=QVGYDSZTIAGYSK-UHFFFAOYSA-N
SMILES:OC=1C=2C(NC(=O)C1C(OC)=O)=CC=CC2
Synonyms:- Methyl 1,2-dihydro-4-hydroxy-2-oxo-3-quinolinecarboxylate
- Methyl 2,4-dihydroxy-3-quinolinedicarboxylate
- Methyl 4-hydroxy-2-oxo-3(1H)-quinolinecarboxylate
- 3-Quinolinecarboxylic acid, 1,2-dihydro-4-hydroxy-2-oxo-, methyl ester
- 3-Quinolinecarboxylic acid, 2,4-dihydroxy-, methyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.