CAS 73776-25-7

2-Chloro-3-quinolinecarboxylic acid

Description:

2-Chloro-3-quinolinecarboxylic acid is an organic compound characterized by its quinoline structure, which consists of a bicyclic aromatic system containing a nitrogen atom. This compound features a carboxylic acid functional group (-COOH) and a chlorine atom at the second position of the quinoline ring. It is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the presence of the carboxylic acid group. The chlorine substituent can influence its reactivity and potential applications in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals. The compound may also exhibit biological activity, making it of interest in medicinal chemistry. Its molecular structure allows for various chemical transformations, including esterification and amide formation. Safety data should be consulted for handling, as with many chlorinated compounds, it may pose health risks if not managed properly. Overall, 2-Chloro-3-quinolinecarboxylic acid is a versatile compound with potential applications in various fields of chemistry.

Formula: C₁₀H₆ClNO₂

InChI: InChI=1S/C10H6ClNO2/c11-9-7(10(13)14)5-6-3-1-2-4-8(6)12-9/h1-5H,(H,13,14)

InChI key: InChIKey=XFSORZYTTCOBFN-UHFFFAOYSA-N

SMILES: C(O)(=O)C1=CC2=C(N=C1Cl)C=CC=C2

Synonyms:

• 3-Quinolinecarboxylic acid, 2-chloro-
• 2-Chloro-3-quinolinecarboxylic acid

2-Chloro-3-quinolinecarboxylic acid

CAS: 73776-25-7

Formula: C₁₀H₆ClNO₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 207.6131

Ref: IN-DA00339Q

2-Chloroquinoline-3-carboxylic acid

CAS: 73776-25-7

2-Chloroquinoline-3-carboxylic acid

Formula: C₁₀H₆ClNO₂

Purity: 99%

Color and Shape: grey solid

Molecular weight: 207.61g/mol

Ref: 54-OR5757

2-Chloro-3-quinolinecarboxylic acid

CAS: 73776-25-7

Formula: C₁₀H₆ClNO₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 207.61

Ref: 10-F066317

2-Chloro-3-quinolinecarboxylic acid

CAS: 73776-25-7

2-Chloro-3-quinolinecarboxylic acid is a versatile chemical compound with various applications. It can be used as a phosphite in the synthesis of other compounds such as ofloxacin and imatinib. Additionally, it has been studied for its potential effects on acetylcholine receptors and its ability to inhibit certain enzymes. This compound is soluble in methanol and can be precipitated by trichloroacetic acid or other precipitants such as gadolinium or maleate salts. It is also used in the research field as a tool for studying fatty acids and their metabolism. Furthermore, 2-Chloro-3-quinolinecarboxylic acid has been utilized in the development of new research chemicals, including emission probes, benzoate derivatives, electrode materials, and ligands for pharmaceuticals such as palonosetron and dasatinib. Its wide range of applications makes it an essential component in various industries.

Formula: C₁₀H₆ClNO₂

Purity: Min. 95%

Molecular weight: 207.62 g/mol

Ref: 3D-YCA77625