CAS 73777-50-1

ammonium (2S)-2-amino-4-[hydroxy(methyl)phosphoryl]butanoate

Description:

Ammonium (2S)-2-amino-4-[hydroxy(methyl)phosphoryl]butanoate, also known by its CAS number 73777-50-1, is an organic compound that features a chiral center, indicating it exists in a specific stereoisomeric form. This substance is characterized by the presence of an ammonium group, an amino group, and a phosphoryl moiety, which contribute to its biological activity and potential applications in biochemistry and pharmaceuticals. The hydroxy(methyl)phosphoryl group suggests that it may play a role in metabolic processes, possibly as a phosphonate or phosphonic acid derivative. Its structure indicates that it can participate in hydrogen bonding due to the hydroxyl group, enhancing its solubility in polar solvents. Additionally, the presence of both amino and carboxyl functional groups suggests that it can act as a zwitterion, which may influence its behavior in biological systems. Overall, this compound's unique structural features make it of interest in research related to amino acids, phosphates, and their derivatives in various biochemical contexts.

Formula: C₅H₁₅N₂O₄P

InChI: InChI=1/C5H12NO4P.H3N/c1-11(9,10)3-2-4(6)5(7)8;/h4H,2-3,6H2,1H3,(H,7,8)(H,9,10);1H3/t4-;/m0./s1

SMILES: CP(=O)(CC[C@@H](C(=O)O)N)O.N

Synonyms:

• 73777-50-1
• Ammonium (2S)-2-amino-4-[hydroxy(methyl)phosphoryl]butanoate