CymitQuimica logo

CAS 73778-94-6

:

5-Amino-1,3-dihydro-1,3,6-trimethyl-2H-benzimidazol-2-one

Description:
5-Amino-1,3-dihydro-1,3,6-trimethyl-2H-benzimidazol-2-one is a chemical compound characterized by its unique structure, which includes a benzimidazole core with amino and methyl substituents. This compound typically appears as a solid and is soluble in polar solvents, reflecting its potential for various applications in pharmaceuticals and biochemistry. The presence of the amino group suggests it may participate in hydrogen bonding, enhancing its reactivity and interaction with biological systems. The trimethyl groups contribute to its lipophilicity, which can influence its bioavailability and pharmacokinetic properties. As a benzimidazole derivative, it may exhibit biological activities, including antimicrobial or antifungal properties, making it of interest in medicinal chemistry. Additionally, its stability under standard conditions and potential for modification through further chemical reactions can be advantageous for developing new derivatives with enhanced efficacy or specificity. Overall, this compound represents a versatile scaffold for further research and application in various chemical and biological contexts.
Formula:C10H13N3O
InChI:InChI=1S/C10H13N3O/c1-6-4-8-9(5-7(6)11)13(3)10(14)12(8)2/h4-5H,11H2,1-3H3
InChI key:InChIKey=DHPXTEFKFUCWDK-UHFFFAOYSA-N
SMILES:CN1C=2C(N(C)C1=O)=CC(N)=C(C)C2
Synonyms:
  • 2H-Benzimidazol-2-one, 5-amino-1,3-dihydro-1,3,6-trimethyl-
  • 5-Amino-1,3,6-trimethyl-1,3-dihydro-benzoimidazol-2-one
  • 5-Amino-1,3-dihydro-1,3,6-trimethyl-2H-benzimidazol-2-one
  • 5-Amino-1,3,6-trimethyl-1H-benzo[d]imidazol-2(3H)-one
Found 4 products.