CymitQuimica logo

CAS 737797-18-1

:

chloro-[(3,4-dichlorophenyl)methyl]zinc

Description:
Chloro-[(3,4-dichlorophenyl)methyl]zinc, with the CAS number 737797-18-1, is an organozinc compound characterized by the presence of a zinc atom coordinated to a chloro group and a 3,4-dichlorophenylmethyl moiety. This compound typically exhibits a white to light yellow solid appearance and is soluble in organic solvents such as dichloromethane and tetrahydrofuran, but is generally insoluble in water. The presence of the dichlorophenyl group imparts significant electronic properties, making it useful in various synthetic applications, particularly in organic synthesis and catalysis. As an organometallic compound, it can participate in reactions such as nucleophilic substitutions and cross-coupling reactions, which are valuable in the formation of carbon-carbon bonds. However, due to the presence of chlorine and zinc, it should be handled with care, as it may pose health and environmental risks. Proper safety protocols should be followed when working with this compound in laboratory settings.
Formula:C7H5Cl3Zn
InChI:InChI=1/C7H5Cl2.ClH.Zn/c1-5-2-3-6(8)7(9)4-5;;/h2-4H,1H2;1H;/q;;+1/p-1/rC7H5Cl3Zn/c8-6-2-1-5(4-11-10)3-7(6)9/h1-3H,4H2
SMILES:C=C1C=CC(C(=C1)Cl)Cl.Cl.[Zn]
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.