CymitQuimica logo

CAS 737797-20-5

:

chloro-[(2,5-dichlorophenyl)methyl]zinc

Description:
Chloro-[(2,5-dichlorophenyl)methyl]zinc is an organozinc compound characterized by the presence of a zinc atom coordinated to a chloro group and a 2,5-dichlorophenylmethyl group. This compound typically exhibits a white to light yellow solid appearance and is soluble in organic solvents such as dichloromethane and tetrahydrofuran. It is known for its reactivity, particularly in organometallic chemistry, where it can participate in various coupling reactions and serve as a reagent in organic synthesis. The presence of the dichlorophenyl group enhances its electrophilic properties, making it useful in the formation of carbon-carbon bonds. Additionally, due to the presence of chlorine atoms, it may exhibit specific interactions with other chemical species, influencing its reactivity and stability. Safety precautions should be taken when handling this compound, as organozinc reagents can be sensitive to moisture and air, potentially leading to hazardous reactions. Overall, chloro-[(2,5-dichlorophenyl)methyl]zinc is a valuable compound in synthetic organic chemistry, particularly in the development of complex molecular architectures.
Formula:C7H5Cl3Zn
InChI:InChI=1/C7H5Cl2.ClH.Zn/c1-5-4-6(8)2-3-7(5)9;;/h2-4H,1H2;1H;/q;;+1/p-1/rC7H5Cl3Zn/c8-6-1-2-7(9)5(3-6)4-11-10/h1-3H,4H2
SMILES:C=C1C=C(C=CC1Cl)Cl.Cl.[Zn]
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.