CAS 737797-22-7

chloro-[(2,3-dimethoxyphenyl)methyl]zinc

Description:

Chloro-[(2,3-dimethoxyphenyl)methyl]zinc is an organozinc compound characterized by the presence of a zinc atom coordinated to a chloro group and a 2,3-dimethoxyphenylmethyl moiety. This compound typically exhibits properties associated with organometallic compounds, such as reactivity towards electrophiles and nucleophiles, making it useful in various synthetic applications, particularly in organic synthesis and catalysis. The presence of the dimethoxyphenyl group enhances its solubility in organic solvents and may influence its reactivity and stability. Additionally, the zinc center can participate in transmetalation reactions, which are valuable in cross-coupling processes. The compound is likely to be sensitive to moisture and air, necessitating careful handling under inert conditions. Its unique structure may also impart specific electronic properties, making it a candidate for applications in materials science and medicinal chemistry. Overall, chloro-[(2,3-dimethoxyphenyl)methyl]zinc represents a versatile building block in the field of organometallic chemistry.

Formula: C₉H₁₁ClO₂Zn

InChI: InChI=1/C9H11O2.ClH.Zn/c1-7-5-4-6-8(10-2)9(7)11-3;;/h4-6H,1H2,2-3H3;1H;/q;;+1/p-1/rC9H11ClO2Zn/c1-11-8-5-3-4-7(6-13-10)9(8)12-2/h3-5H,6H2,1-2H3

SMILES: C=C1C=CC=C(C1OC)OC.Cl.[Zn]