CAS 737797-24-9
:chloro-[(2,5-dimethylphenyl)methyl]zinc
Description:
Chloro-[(2,5-dimethylphenyl)methyl]zinc, with the CAS number 737797-24-9, is an organozinc compound characterized by the presence of a zinc atom bonded to a chloro group and a 2,5-dimethylphenylmethyl group. This compound typically exhibits properties associated with organometallic compounds, such as reactivity with various electrophiles and potential use in organic synthesis, particularly in carbon-carbon bond formation. The presence of the chloro group suggests that it may participate in nucleophilic substitution reactions, while the bulky 2,5-dimethylphenyl group can influence the steric and electronic properties of the molecule, affecting its reactivity and stability. Organometallic compounds like this one are often sensitive to moisture and air, necessitating careful handling under inert atmospheres. Additionally, they may serve as intermediates in the synthesis of pharmaceuticals, agrochemicals, or other complex organic molecules. Overall, chloro-[(2,5-dimethylphenyl)methyl]zinc represents a versatile building block in synthetic organic chemistry.
Formula:C9H11ClZn
InChI:InChI=1/C9H11.ClH.Zn/c1-7-4-5-8(2)9(3)6-7;;/h4-6H,3H2,1-2H3;1H;/q;;+1/p-1/rC9H11ClZn/c1-7-3-4-8(2)9(5-7)6-11-10/h3-5H,6H2,1-2H3
SMILES:CC1=CC(=C)C(C)C=C1.Cl.[Zn]
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.