CAS 737797-32-9

bromo-(4-phenoxybutyl)zinc

Description:

Bromo-(4-phenoxybutyl)zinc, identified by its CAS number 737797-32-9, is an organozinc compound characterized by the presence of a zinc atom bonded to a bromo group and a 4-phenoxybutyl moiety. This compound typically exhibits properties associated with organometallics, such as reactivity towards electrophiles and nucleophiles, making it useful in various synthetic applications, particularly in organic synthesis and catalysis. The presence of the phenoxy group enhances its solubility in organic solvents and may influence its reactivity and stability. As an organozinc reagent, it can participate in cross-coupling reactions, allowing for the formation of carbon-carbon bonds. Additionally, the bromine atom serves as a leaving group, facilitating nucleophilic substitution reactions. Safety considerations should be taken into account when handling this compound, as organozinc reagents can be sensitive to moisture and air, potentially leading to hazardous reactions. Overall, bromo-(4-phenoxybutyl)zinc is a valuable reagent in the field of synthetic organic chemistry.

Formula: C₁₀H₁₃BrOZn

InChI: InChI=1/C10H13O.BrH.Zn/c1-2-3-9-11-10-7-5-4-6-8-10;;/h4-8H,1-3,9H2;1H;/q;;+1/p-1/rC10H13BrOZn/c11-13-9-5-4-8-12-10-6-2-1-3-7-10/h1-3,6-7H,4-5,8-9H2

SMILES: [CH2]CCCOc1ccccc1.Br.[Zn]