CymitQuimica logo

CAS 737797-36-3

:

(5-chloro-2-methoxy-phenyl)-iodo-zinc

Description:
(5-Chloro-2-methoxy-phenyl)-iodo-zinc, with the CAS number 737797-36-3, is an organozinc compound characterized by the presence of a zinc atom bonded to an iodo group and a substituted phenyl ring. The phenyl ring features a chlorine atom at the 5-position and a methoxy group at the 2-position, contributing to its unique reactivity and properties. Organozinc compounds are typically used as reagents in organic synthesis, particularly in cross-coupling reactions, due to their ability to act as nucleophiles. The presence of the iodine atom enhances its reactivity, making it suitable for various transformations in synthetic chemistry. Additionally, the methoxy group can influence the electronic properties of the molecule, potentially affecting its reactivity and solubility in different solvents. Overall, this compound is valuable in the field of organic synthesis, particularly in the development of complex molecules and pharmaceuticals.
Formula:C7H6ClIOZn
InChI:InChI=1/C7H6ClO.HI.Zn/c1-9-7-4-2-6(8)3-5-7;;/h2-4H,1H3;1H;/q;;+1/p-1/rC7H6ClIOZn/c1-10-6-3-2-5(8)4-7(6)11-9/h2-4H,1H3
SMILES:COC1=C=CC(C=C1)Cl.I.[Zn]
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.