CymitQuimica logo

CAS 737797-38-5

:

(2-chloro-6-methyl-phenyl)-iodo-zinc

Description:
(2-Chloro-6-methyl-phenyl)-iodo-zinc, with the CAS number 737797-38-5, is an organozinc compound characterized by the presence of a zinc atom bonded to an iodo group and a substituted phenyl ring. This compound typically exhibits properties associated with organometallics, such as reactivity towards electrophiles and nucleophiles, making it useful in various synthetic applications, particularly in organic synthesis and cross-coupling reactions. The presence of the chloro and methyl substituents on the phenyl ring can influence its reactivity and solubility, affecting its behavior in chemical reactions. Organozinc compounds are generally stable under anhydrous conditions but can be sensitive to moisture and air, which may lead to hydrolysis or oxidation. Additionally, the compound's structure suggests potential applications in medicinal chemistry and materials science, where organozinc reagents are often employed for the formation of carbon-carbon bonds. As with all chemical substances, handling should be conducted with appropriate safety measures due to potential toxicity and reactivity.
Formula:C7H6ClIZn
InChI:InChI=1/C7H6Cl.HI.Zn/c1-6-3-2-4-7(8)5-6;;/h2-4H,1H3;1H;/q;;+1/p-1/rC7H6ClIZn/c1-5-3-2-4-6(8)7(5)10-9/h2-4H,1H3
SMILES:Cc1cccc(c1)Cl.I.[Zn]
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.