CAS 737797-40-9

5-acetoxypentyl-bromo-zinc

Description:

5-Acetoxypentyl-bromo-zinc, identified by the CAS number 737797-40-9, is a chemical compound that features a zinc atom coordinated with a bromo group and an acetoxypentyl moiety. This compound is characterized by its organozinc nature, which typically exhibits reactivity that can be utilized in various organic synthesis reactions, particularly in coupling reactions and as a reagent in the formation of carbon-carbon bonds. The presence of the acetoxy group suggests that it may participate in acylation reactions or serve as a leaving group in nucleophilic substitutions. The pentyl chain contributes to the hydrophobic characteristics of the molecule, influencing its solubility and reactivity in different solvents. Additionally, the bromine atom can serve as a site for further functionalization or substitution, making this compound versatile in synthetic organic chemistry. Overall, 5-acetoxypentyl-bromo-zinc is a valuable intermediate in the synthesis of more complex organic molecules.

Formula: C₇H₁₃BrO₂Zn

InChI: InChI=1/C7H13O2.BrH.Zn/c1-3-4-5-6-9-7(2)8;;/h1,3-6H2,2H3;1H;/q;;+1/p-1/rC7H13BrO2Zn/c1-7(9)10-5-3-2-4-6-11-8/h2-6H2,1H3

SMILES: [CH2]CCCCOC(=O)C.Br.[Zn]