CAS 737797-44-3
:iodo-(2,3,5,6-tetramethylphenyl)zinc
Description:
Iodo-(2,3,5,6-tetramethylphenyl)zinc, with the CAS number 737797-44-3, is an organozinc compound characterized by the presence of a zinc atom bonded to an iodo-substituted aromatic ring, specifically 2,3,5,6-tetramethylphenyl. This compound typically exhibits a white to light yellow solid appearance and is sensitive to moisture and air, necessitating careful handling under inert atmospheres. It is often utilized in organic synthesis, particularly in cross-coupling reactions, due to its ability to act as a nucleophile. The presence of the bulky tetramethyl groups enhances its reactivity and solubility in organic solvents, making it a valuable reagent in the formation of carbon-carbon bonds. Additionally, the iodo substituent serves as a leaving group, facilitating various transformations in synthetic pathways. As with many organometallic compounds, safety precautions are essential, as it may be reactive and potentially hazardous upon exposure to air or water.
Formula:C10H13IZn
InChI:InChI=1/C10H13.HI.Zn/c1-7-5-9(3)10(4)6-8(7)2;;/h5H,1-4H3;1H;/q;;+1/p-1/rC10H13IZn/c1-6-5-7(2)9(4)10(12-11)8(6)3/h5H,1-4H3
SMILES:CC1=CC(C)C(=C=C1C)C.I.[Zn]
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.