CAS 737797-48-7

bromo-[(4-tert-butylphenyl)methyl]zinc

Description:

Bromo-[(4-tert-butylphenyl)methyl]zinc is an organozinc compound characterized by the presence of a zinc atom bonded to a bromo group and a 4-tert-butylphenylmethyl group. This compound typically exhibits properties associated with organometallics, such as reactivity towards electrophiles and nucleophiles, making it useful in various synthetic applications, particularly in organic synthesis and catalysis. The tert-butyl group contributes to the steric bulk, influencing the compound's reactivity and solubility in organic solvents. Additionally, the presence of the bromine atom allows for potential halogen exchange reactions, which can be exploited in further chemical transformations. As with many organozinc compounds, it is likely to be sensitive to moisture and air, necessitating careful handling under inert conditions. Overall, bromo-[(4-tert-butylphenyl)methyl]zinc serves as a valuable reagent in the field of synthetic organic chemistry, particularly in the formation of carbon-carbon bonds and other functional group transformations.

Formula: C₁₁H₁₅BrZn

InChI: InChI=1/C11H15.BrH.Zn/c1-9-5-7-10(8-6-9)11(2,3)4;;/h5-8H,1H2,2-4H3;1H;/q;;+1/p-1/rC11H15BrZn/c1-11(2,3)10-6-4-9(5-7-10)8-13-12/h4-7H,8H2,1-3H3

SMILES: C=C1C=CC(C=C1)C(C)(C)C.Br.[Zn]