CAS 73784-45-9
:(3R)-3-[(5-fluoro-2,4-dinitrophenyl)amino]-2,2,5,5-tetramethylpyrrolidin-1-ol
Description:
The chemical substance known as (3R)-3-[(5-fluoro-2,4-dinitrophenyl)amino]-2,2,5,5-tetramethylpyrrolidin-1-ol, with the CAS number 73784-45-9, is a complex organic compound characterized by its unique structural features. It contains a pyrrolidine ring, which is a five-membered nitrogen-containing heterocycle, substituted with a hydroxyl group and a bulky dinitrophenyl moiety that includes a fluorine atom. This compound exhibits chirality due to the presence of a stereocenter at the pyrrolidine ring, specifically in the (3R) configuration, which can influence its biological activity and interactions. The presence of the dinitrophenyl group suggests potential applications in fields such as pharmaceuticals or agrochemicals, as such groups are often associated with bioactivity. Additionally, the fluorine atom can enhance the compound's lipophilicity and metabolic stability. Overall, this substance's characteristics make it a subject of interest for further research, particularly in medicinal chemistry and related disciplines.
Formula:C14H19FN4O5
InChI:InChI=1/C14H19FN4O5/c1-13(2)7-12(14(3,4)19(13)24)16-9-5-8(15)10(17(20)21)6-11(9)18(22)23/h5-6,12,16,24H,7H2,1-4H3/t12-/m1/s1
SMILES:CC1(C)C[C@H](C(C)(C)N1O)Nc1cc(c(cc1N(=O)=O)N(=O)=O)F
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.