CAS 73785-40-7
:N′-Cyano-N-methyl-N′′-[2-[[(4-methyl-1H-imidazol-5-yl)methyl]thio]ethyl]-N-nitrosoguanidine
Description:
N′-Cyano-N-methyl-N′′-[2-[[(4-methyl-1H-imidazol-5-yl)methyl]thio]ethyl]-N-nitrosoguanidine, commonly referred to by its CAS number 73785-40-7, is a synthetic organic compound characterized by its complex structure, which includes a nitrosoguanidine moiety, a cyano group, and a thioether linkage. This compound is notable for its potential biological activity, particularly in the context of medicinal chemistry and pharmacology. It may exhibit properties such as mutagenicity or cytotoxicity, which are often associated with nitrosamines and related compounds. The presence of the imidazole ring suggests potential interactions with biological targets, possibly influencing enzyme activity or receptor binding. Additionally, the compound's stability, solubility, and reactivity can vary based on environmental conditions, making it important to handle it with care in laboratory settings. As with many nitrosated compounds, it is essential to consider safety and regulatory guidelines due to potential health risks associated with exposure.
Formula:C10H15N7OS
InChI:InChI=1S/C10H15N7OS/c1-8-9(15-7-14-8)5-19-4-3-12-10(13-6-11)17(2)16-18/h7H,3-5H2,1-2H3,(H,12,13)(H,14,15)
InChI key:InChIKey=LFTUYYPQNCJQGN-UHFFFAOYSA-N
SMILES:C(SCCN=C(N(N=O)C)NC#N)C1=C(C)N=CN1
Synonyms:- N-Nitrosocimetidine
- N′-Cyano-N-methyl-N′′-[2-[[(4-methyl-1H-imidazol-5-yl)methyl]thio]ethyl]-N-nitrosoguanidine
- Nitrosocimetidine
- Guanidine, N′-cyano-N-methyl-N′′-[2-[[(5-methyl-1H-imidazol-4-yl)methyl]thio]ethyl]-N-nitroso-
- Guanidine, N′-cyano-N-methyl-N′′-[2-[[(4-methyl-1H-imidazol-5-yl)methyl]thio]ethyl]-N-nitroso-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
