CAS 73785-43-0

6-(4-nitrophenoxy)-6-oxohexyl 2-(trimethylammonio)ethyl phosphate

Description:

6-(4-Nitrophenoxy)-6-oxohexyl 2-(trimethylammonio)ethyl phosphate, with the CAS number 73785-43-0, is a chemical compound that features a complex structure incorporating a phosphate group, a nitrophenyl moiety, and a quaternary ammonium group. This compound is characterized by its amphiphilic nature, which allows it to interact with both hydrophilic and hydrophobic environments, making it potentially useful in various applications such as surfactants, emulsifiers, or in drug delivery systems. The presence of the nitrophenyl group may impart specific electronic properties, influencing its reactivity and interaction with biological systems. Additionally, the quaternary ammonium component contributes to its solubility in aqueous solutions and can enhance its antimicrobial properties. Overall, this compound's unique structural features suggest potential utility in fields such as medicinal chemistry, materials science, and biochemistry, although specific applications would depend on further research into its behavior and interactions in different environments.

Formula: C₁₇H₂₇N₂O₈P

InChI: InChI=1/C17H27N2O8P/c1-19(2,3)12-14-26-28(23,24)25-13-6-4-5-7-17(20)27-16-10-8-15(9-11-16)18(21)22/h8-11H,4-7,12-14H2,1-3H3

SMILES: C[N+](C)(C)CCOP(=O)([O-])OCCCCCC(=O)Oc1ccc(cc1)N(=O)=O

alpha,alpha,alpha-Trifluorotoluene

Controlled Product

CAS: 73785-43-0

Stability Moisture and Temperature Sensitive
Applications A novel phosphorylcholine ester used in immmunological studies.
References Isakson, P.C., et al.: J. Immunol. Methods, 25, 89 (1979),

Formula: C₁₇H₂₇N₂O₈P

Color and Shape: Neat

Molecular weight: 418.38

Ref: TR-C178460