CymitQuimica logo

CAS 7379-49-9

:

2,6-dimethyl-4-(methylsulfanyl)phenol

Description:
2,6-Dimethyl-4-(methylsulfanyl)phenol, with the CAS number 7379-49-9, is an organic compound that belongs to the class of phenolic compounds. It features a phenol ring substituted with two methyl groups at the 2 and 6 positions and a methylthio group at the 4 position. This compound is characterized by its aromatic structure, which contributes to its stability and reactivity. The presence of the hydroxyl (-OH) group imparts acidic properties, allowing it to participate in hydrogen bonding, which can influence its solubility in various solvents. The methylthio group enhances its potential for biological activity, making it of interest in various fields, including pharmaceuticals and agrochemicals. Additionally, the compound may exhibit antioxidant properties due to the presence of the phenolic hydroxyl group. Its physical properties, such as melting point and boiling point, can vary based on purity and environmental conditions. Overall, 2,6-dimethyl-4-(methylsulfanyl)phenol is a versatile compound with potential applications in different chemical and industrial processes.
Formula:C9H12OS
InChI:InChI=1/C9H12OS/c1-6-4-8(11-3)5-7(2)9(6)10/h4-5,10H,1-3H3
SMILES:Cc1cc(cc(C)c1O)SC
Synonyms:
  • Phenol, 2,6-Dimethyl-4-(Methylthio)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.