CymitQuimica logo

CAS 73791-20-5

:

2-chloro-6-methyl-4-nitrosophenol

Description:
2-Chloro-6-methyl-4-nitrosophenol is an organic compound characterized by its aromatic structure, which includes a phenolic group, a nitroso group, and a chlorine atom. The presence of the nitroso group (-NO) contributes to its potential reactivity and biological activity. This compound typically appears as a solid at room temperature and may exhibit a range of colors depending on its purity and form. It is soluble in organic solvents but has limited solubility in water due to its hydrophobic aromatic structure. The chlorine substituent at the second position and the methyl group at the sixth position of the phenolic ring influence its chemical properties, including its reactivity and potential applications in various fields, such as pharmaceuticals or agrochemicals. Additionally, the compound may exhibit specific toxicological properties, necessitating careful handling and consideration of safety protocols during its use in laboratory or industrial settings. As with many nitroso compounds, it may also be subject to regulatory scrutiny due to potential health and environmental impacts.
Formula:C7H6ClNO2
InChI:InChI=1/C7H6ClNO2/c1-4-2-5(9-11)3-6(8)7(4)10/h2-3,10H,1H3
SMILES:Cc1cc(cc(c1O)Cl)N=O
Synonyms:
  • 2-Chloro-6-methyl-4-nitrosophenol
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.