CAS 73791-37-4
:(7aS)-4,10,11-trimethoxy-7-methyl-6,7,7a,8-tetrahydro-5H-[1,3]benzodioxolo[6,5,4-de]benzo[g]quinoline
Description:
The chemical substance known as (7aS)-4,10,11-trimethoxy-7-methyl-6,7,7a,8-tetrahydro-5H-[1,3]benzodioxolo[6,5,4-de]benzo[g]quinoline, with the CAS number 73791-37-4, is a complex organic compound characterized by its unique polycyclic structure. This compound features multiple methoxy groups, which are known to enhance solubility and influence biological activity. The presence of a tetrahydroquinoline framework suggests potential interactions with biological systems, possibly indicating pharmacological properties. Its stereochemistry, particularly the (7aS) configuration, implies specific spatial arrangements that can affect its reactivity and interactions with other molecules. The benzodioxole moiety contributes to its aromatic character, potentially impacting its electronic properties. Overall, this compound may exhibit interesting chemical behavior and biological activity, making it a subject of interest in medicinal chemistry and related fields. Further studies would be necessary to elucidate its specific properties, potential applications, and mechanisms of action.
Formula:C21H23NO5
InChI:InChI=1/C21H23NO5/c1-22-6-5-12-17-14(22)7-11-8-15(23-2)16(24-3)9-13(11)18(17)20-21(19(12)25-4)27-10-26-20/h8-9,14H,5-7,10H2,1-4H3/t14-/m0/s1
Synonyms:- 5H-Benzo(g)-1,3-benzodioxolo(6,5,4-de)quinoline, 6,7,7a,8-tetrahydro-4,10,11-trimethoxy-7-methyl-, (S)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Ocoteine
CAS:Ocoteine is an alpha 1-adrenoceptor antagonist.Formula:C21H23NO5Color and Shape:SolidMolecular weight:369.42
