CAS 73792-06-0

ethyl 4-amino-2-fluorobenzoate

Description:

Ethyl 4-amino-2-fluorobenzoate, with the CAS number 73792-06-0, is an organic compound that belongs to the class of benzoate esters. It features a benzoate structure where a fluorine atom is substituted at the 2-position and an amino group is present at the 4-position of the aromatic ring. This compound is typically characterized by its moderate solubility in organic solvents and limited solubility in water, which is common for many aromatic esters. The presence of the amino group imparts basic properties, while the fluorine atom can influence the compound's reactivity and polarity. Ethyl 4-amino-2-fluorobenzoate may be utilized in various chemical syntheses and research applications, particularly in the development of pharmaceuticals or agrochemicals. Its specific reactivity and interactions can be influenced by the functional groups present, making it a subject of interest in medicinal chemistry and materials science. Safety data should be consulted for handling and usage, as with any chemical substance.

Formula: C₉H₁₀FNO₂

InChI: InChI=1/C9H10FNO2/c1-2-13-9(12)7-4-3-6(11)5-8(7)10/h3-5H,2,11H2,1H3

SMILES: CCOC(=O)c1ccc(cc1F)N

Synonyms:

• Benzoic acid, 4-amino-2-fluoro-, ethyl ester
• Ethyl 4-amino-2-fluorobenzoate

Ethyl 4-amino-2-fluorobenzoate

CAS: 73792-06-0

Formula: C₉H₁₀FNO₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 183.1796

Ref: IN-DA005KHV

Ethyl 4-amino-2-fluorobenzoate

CAS: 73792-06-0

Ethyl 4-amino-2-fluorobenzoate

Purity: 98%

Molecular weight: 183.18g/mol

Ref: 54-PC903639

Ethyl 4-amino-2-fluorobenzoate

CAS: 73792-06-0

Formula: C₉H₁₀FNO₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 183.182

Ref: 10-F037784

Ethyl 4-Amino-2-fluorobenzoate

Controlled Product

CAS: 73792-06-0

Applications ETHYL 4-AMINO-2-FLUOROBENZOATE (cas# 73792-06-0) is a useful research chemical.

Formula: C₉H₁₀NO₂F

Color and Shape: Neat

Molecular weight: 183.18

Ref: TR-E940060