CAS 73792-08-2
:Methyl 4-amino-2-fluorobenzoate
Description:
Methyl 4-amino-2-fluorobenzoate, with the CAS number 73792-08-2, is an organic compound that belongs to the class of benzoate esters. It features a methyl ester functional group attached to a benzoic acid derivative, which includes an amino group and a fluorine atom on the aromatic ring. This compound typically appears as a solid or liquid, depending on its purity and specific conditions. Its molecular structure contributes to its potential applications in pharmaceuticals and agrochemicals, particularly as an intermediate in the synthesis of various biologically active compounds. The presence of the amino and fluorine substituents can influence its reactivity, solubility, and biological activity. Methyl 4-amino-2-fluorobenzoate may exhibit properties such as moderate polarity and potential for hydrogen bonding due to the amino group. Safety data should be consulted for handling and usage, as with any chemical substance, to ensure proper precautions are taken.
Formula:C8H8FNO2
InChI:InChI=1/C8H8FNO2/c1-12-8(11)6-3-2-5(10)4-7(6)9/h2-4H,10H2,1H3
SMILES:COC(=O)c1ccc(cc1F)N
Synonyms:- Benzoic acid, 4-amino-2-fluoro-, methyl ester
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
Methyl 4-amino-2-fluorobenzoate
CAS:Formula:C8H8FNO2Purity:97%Color and Shape:SolidMolecular weight:169.1530Methyl 4-amino-2-fluorobenzoate
CAS:Methyl 4-amino-2-fluorobenzoatePurity:98%Molecular weight:169.15g/molMethyl 4-amino-2-fluorobenzoate
CAS:Formula:C8H8FNO2Purity:97%Color and Shape:SolidMolecular weight:169.155Methyl 4-amino-2-fluorobenzoate
CAS:Controlled ProductApplications Methyl 4-amino-2-fluorobenzoate
Formula:C8H8FNO2Color and Shape:NeatMolecular weight:169.15Methyl 4-amino-2-fluorobenzoate
CAS:Please enquire for more information about Methyl 4-amino-2-fluorobenzoate including the price, delivery time and more detailed product information at the technical inquiry form on this page
Formula:C8H8FNO2Purity:Min. 95%Molecular weight:169.15 g/mol





