CAS 73792-12-8

Ethyl 4-amino-3-fluorobenzoate

Description:

Ethyl 4-amino-3-fluorobenzoate, with the CAS number 73792-12-8, is an organic compound that belongs to the class of benzoate esters. It features a benzoic acid derivative where an ethyl group is esterified to the carboxylic acid, and it contains an amino group and a fluorine atom on the aromatic ring. This compound typically appears as a solid or liquid, depending on its purity and specific conditions. Its molecular structure contributes to its potential applications in pharmaceuticals and agrochemicals, particularly as an intermediate in the synthesis of various biologically active compounds. Ethyl 4-amino-3-fluorobenzoate may exhibit properties such as moderate solubility in organic solvents and limited solubility in water, which is common for many aromatic compounds. Additionally, the presence of the amino and fluorine substituents can influence its reactivity and interaction with biological systems, making it a subject of interest in medicinal chemistry. Safety data should be consulted for handling and storage, as with all chemical substances.

Formula: C₉H₁₀FNO₂

InChI: InChI=1/C9H10FNO2/c1-2-13-9(12)6-3-4-8(11)7(10)5-6/h3-5H,2,11H2,1H3

SMILES: CCOC(=O)c1ccc(c(c1)F)N

Synonyms:

• Benzoic acid, 4-amino-3-fluoro-, ethyl ester

Ethyl 4-amino-3-fluorobenzoate

CAS: 73792-12-8

Formula: C₉H₁₀FNO₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 183.1796

Ref: IN-DA00FEBG

Ethyl 4-amino-3-fluorobenzoate

CAS: 73792-12-8

Ethyl 4-amino-3-fluorobenzoate

Purity: 97%

Molecular weight: 183.18g/mol

Ref: 54-PC201297

Ethyl-4-amino-3-fluorobenzoate

CAS: 73792-12-8

Formula: C₉H₁₀FNO₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 183.182

Ref: 10-F034839

Ethyl 4-amino-3-fluorobenzoate

Controlled Product

CAS: 73792-12-8

Applications Ethyl 4-amino-3-fluorobenzoate

Formula: C₉H₁₀FNO₂

Color and Shape: Neat

Molecular weight: 183.18

Ref: TR-E899500