CAS 73792-49-1

4-Amino-3-fluorobenzenepropanoic acid

Description:

4-Amino-3-fluorobenzenepropanoic acid, with the CAS number 73792-49-1, is an organic compound characterized by the presence of an amino group (-NH2), a fluorine atom, and a propanoic acid moiety. This compound features a benzene ring substituted at the 4-position with an amino group and at the 3-position with a fluorine atom, which influences its chemical reactivity and properties. The presence of the amino group makes it a potential candidate for various biological applications, including as a building block in pharmaceuticals or agrochemicals. The fluorine atom can enhance the lipophilicity and metabolic stability of the compound, which is often desirable in drug design. Additionally, the carboxylic acid functional group (-COOH) contributes to its acidity and solubility in polar solvents. Overall, 4-Amino-3-fluorobenzenepropanoic acid exhibits characteristics typical of amino acids and aromatic compounds, making it a versatile substance in organic synthesis and medicinal chemistry.

Formula: C₉H₁₀FNO₂

InChI: InChI=1S/C9H10FNO2/c10-7-5-6(1-3-8(7)11)2-4-9(12)13/h1,3,5H,2,4,11H2,(H,12,13)

InChI key: InChIKey=YJGVHBJUBRNLCR-UHFFFAOYSA-N

SMILES: C(CC(O)=O)C1=CC(F)=C(N)C=C1

Synonyms:

• 4-Amino-3-fluorobenzenepropanoic acid
• 4-Amino-3-fluorohydrocinnamic acid
• Benzenepropanoic acid, 4-amino-3-fluoro-