
CAS 73793-80-3
:2-Hydroxymethyl-p-phenylenediamine
Description:
2-Hydroxymethyl-p-phenylenediamine, with the CAS number 73793-80-3, is an organic compound characterized by its aromatic structure, which includes a benzene ring with two amino groups (-NH2) and a hydroxymethyl group (-CH2OH) attached to it. This compound is typically a white to light yellow solid and is soluble in water and organic solvents, making it versatile for various applications. It is primarily used in the dye industry, particularly in the synthesis of hair dyes and other coloring agents, due to its ability to form stable colored complexes. Additionally, 2-Hydroxymethyl-p-phenylenediamine can act as a reducing agent and is involved in various chemical reactions, including polymerization processes. Safety considerations are important, as it may pose health risks upon exposure, necessitating appropriate handling and protective measures in laboratory and industrial settings. Overall, its unique functional groups contribute to its reactivity and utility in chemical synthesis and formulation.
Formula:C7H10N2O
InChI:InChI=1S/C7H10N2O/c8-6-1-2-7(9)5(3-6)4-10/h1-3,10H,4,8-9H2
InChI key:InChIKey=NKNCGBHPGCHYCQ-UHFFFAOYSA-N
SMILES:C(O)C1=C(N)C=CC(N)=C1
Synonyms:- Benzenemethanol, 2,5-diamino-
- 2,5-Diaminobenzyl alcohol
- 1,4-Diamino-2-(hydroxymethyl)benzene
- 2,5-Diaminobenzenemethanol
- 2-Hydroxymethyl-p-phenylenediamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.