CAS 738-75-0

N-(phenylacetyl)-L-phenylalanine

Description:

N-(Phenylacetyl)-L-phenylalanine, with the CAS number 738-75-0, is an amino acid derivative that features a phenylacetyl group attached to the amino acid L-phenylalanine. This compound is characterized by its structural complexity, which includes an aromatic phenyl group and a carboxylic acid functional group, contributing to its potential biological activity. It is typically a white to off-white crystalline solid, soluble in organic solvents but less so in water, reflecting its hydrophobic characteristics due to the presence of the phenyl groups. This compound is of interest in pharmaceutical and biochemical research, particularly for its potential applications in drug design and synthesis, as well as in studies related to protein interactions and enzyme activity. Its unique structure allows it to participate in various chemical reactions, making it a valuable compound in organic synthesis and medicinal chemistry. Additionally, it may exhibit specific biological activities, although detailed studies are necessary to fully understand its mechanisms and applications.

Formula: C₁₇H₁₇NO₃

InChI: InChI=1/C17H17NO3/c19-16(12-14-9-5-2-6-10-14)18-15(17(20)21)11-13-7-3-1-4-8-13/h1-10,15H,11-12H2,(H,18,19)(H,20,21)/t15-/m0/s1

InChI key: InChIKey=LIIPHJDKZNTNII-HNNXBMFYSA-N

SMILES: c1ccc(cc1)C[C@@H](C(=O)O)N=C(Cc1ccccc1)O

Phenylacetyl-L-Phenhylalanine

CAS: 738-75-0

Formula: C₁₇H₁₇NO₃

Purity: 98%

Color and Shape: Solid

Molecular weight: 283.3218

Ref: IN-DA008PP1

N-Phenylacetyl-L-phenylalanine

CAS: 738-75-0

N-Phenylacetyl-L-phenylalanine

Purity: 98%

Molecular weight: 283.32g/mol

Ref: 54-OR91859

Phenylac-Phe-OH

CAS: 738-75-0

Phenylac-Phe-OH is an amphipathic molecule that has been shown to exhibit potent antagonistic activity against proton pumps. This compound also has the potential use in retinoid acid assays, where it was found to be a potent antagonist of retinoic acid. Phenylac-Phe-OH can be used as a probe for magnetic resonance analysis and its metabolic profiles have been studied extensively.

Formula: C₁₇H₁₇NO₃

Purity: Min. 95%

Color and Shape: Powder

Molecular weight: 283.32 g/mol

Ref: 3D-FP111841

N-(PHENYLACETYL)-L-PHENYLALANINE

CAS: 738-75-0

Formula: C₁₇H₁₇NO₃

Purity: 95%

Molecular weight: 283.327

Ref: 10-F500245

N-Phenylacetylphenylalanine

CAS: 738-75-0

N-Phenylacetylphenylalanine is a biaromatic agent with properties that make them suitable candidates for the treatment of sickle cell disease.

Formula: C₁₇H₁₇NO₃

Color and Shape: Solid

Molecular weight: 283.32

Ref: TM-T33730