CAS 7380-40-7: Bergamottin
Description:Bergamottin is a naturally occurring compound classified as a furanocoumarin, primarily found in the essential oil of bergamot oranges (Citrus bergamia). It is known for its role in the grapefruit juice effect, where it can inhibit certain cytochrome P450 enzymes, particularly CYP3A4, which affects the metabolism of various drugs. This inhibition can lead to increased bioavailability of certain medications, potentially resulting in adverse effects or altered therapeutic outcomes. Bergamottin is a colorless to pale yellow liquid with a characteristic citrus aroma, and it is soluble in organic solvents but has limited solubility in water. In addition to its pharmacological implications, bergamottin is also studied for its potential health benefits, including antioxidant and anti-inflammatory properties. However, due to its effects on drug metabolism, caution is advised when consuming bergamot products alongside certain medications. Overall, bergamottin exemplifies the complex interactions between natural compounds and pharmaceutical agents, highlighting the importance of understanding dietary influences on drug efficacy.
Formula:C21H22O4
InChI:InChI=1S/C21H22O4/c1-14(2)5-4-6-15(3)9-11-24-21-16-7-8-20(22)25-19(16)13-18-17(21)10-12-23-18/h5,7-10,12-13H,4,6,11H2,1-3H3/b15-9+
InChI key:InChIKey=DBMJZOMNXBSRED-OQLLNIDSSA-N
SMILES:O=C1OC=2C=C3OC=CC3=C(OCC=C(C)CCC=C(C)C)C2C=C1
- Synonyms:
- 4-[[(2E)-3,7-Dimethyl-2,6-octadien-1-yl]oxy]-7H-furo[3,2-g][1]benzopyran-7-one
- 4-{[(2E)-3,7-dimethylocta-2,6-dien-1-yl]oxy}-7H-furo[3,2-g]chromen-7-one
- 5-Geranoxypsoralen
- 7H-Furo[3,2-g][1]benzopyran-7-one, 4-[(3,7-dimethyl-2,6-octadienyl)oxy]-, (E)-
- 7H-Furo[3,2-g][1]benzopyran-7-one, 4-[[(2E)-3,7-dimethyl-2,6-octadien-1-yl]oxy]-
- 7H-Furo[3,2-g][1]benzopyran-7-one, 4-[[(2E)-3,7-dimethyl-2,6-octadienyl]oxy]-
- Bergamotine
- Bergaptin
- Bergamottin
