CAS 73800-85-8
:2-(fluoromethyl)ornithine
Description:
2-(Fluoromethyl)ornithine is an organic compound characterized by the presence of a fluoromethyl group attached to the ornithine backbone, which is an amino acid involved in the urea cycle. This compound is notable for its potential applications in medicinal chemistry, particularly in the development of inhibitors for arginase, an enzyme that plays a role in the regulation of nitric oxide synthesis and polyamine metabolism. The fluoromethyl group can enhance the compound's biological activity and stability. In terms of physical properties, 2-(fluoromethyl)ornithine is typically a white to off-white solid, soluble in polar solvents due to its amino acid structure. Its molecular structure includes both amine and carboxylic acid functional groups, contributing to its reactivity and interaction with biological systems. As a research chemical, it is primarily utilized in laboratory settings to explore its pharmacological effects and potential therapeutic applications, particularly in cancer research and metabolic disorders. Safety data should be consulted before handling, as with any chemical substance.
Formula:C6H13FN2O2
InChI:InChI=1/C6H13FN2O2/c7-4-6(9,5(10)11)2-1-3-8/h1-4,8-9H2,(H,10,11)
SMILES:C(CC(CF)(C(=O)O)N)CN
Synonyms:- Ornithine, 2-(Fluoromethyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
2-Fluoromethylornithine
CAS:2-Fluoromethylornithine is an ornithine decarboxylase antagonist.Formula:C6H13FN2O2Color and Shape:SolidMolecular weight:164.18
