CAS 73806-49-2
:(1R,2S)-2-[(dimethylamino)methyl]-1-(3-methoxyphenyl)cyclohexanol hydrochloride (1:1)
Description:
The chemical substance known as (1R,2S)-2-[(dimethylamino)methyl]-1-(3-methoxyphenyl)cyclohexanol hydrochloride (1:1) is a hydrochloride salt, which indicates that it is a protonated form of a base, enhancing its solubility in water. This compound features a cyclohexanol core, which is a six-membered carbon ring with a hydroxyl (-OH) group, contributing to its potential as a chiral molecule due to the presence of stereocenters. The dimethylamino group suggests that it may exhibit basic properties, while the methoxyphenyl substituent can influence its pharmacological activity, possibly enhancing lipophilicity and receptor interactions. The specific stereochemistry (1R,2S) indicates the spatial arrangement of atoms, which is crucial for biological activity, as enantiomers can have significantly different effects in biological systems. This compound may be of interest in medicinal chemistry, particularly in the development of pharmaceuticals, due to its structural features that could interact with biological targets. Its hydrochloride form typically improves stability and bioavailability in therapeutic applications.
Formula:C16H26ClNO2
InChI:InChI=1/C16H25NO2.ClH/c1-17(2)12-14-7-4-5-10-16(14,18)13-8-6-9-15(11-13)19-3;/h6,8-9,11,14,18H,4-5,7,10,12H2,1-3H3;1H/t14-,16-;/m0./s1
SMILES:CN(C)C[C@@H]1CCCC[C@@]1(c1cccc(c1)OC)O.Cl
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
(1RS,2SR)-2-[(Dimethylamino)methyl]-1-(3-methoxyphenyl)cyclohexanol Hydrochloride
CAS:Controlled ProductFormula:C16H25NO2·ClHColor and Shape:NeatMolecular weight:299.84rel (1R,2S)-Tramadol Hydrochloride
CAS:Controlled ProductFormula:C16H25NO2·ClHColor and Shape:NeatMolecular weight:299.84(1R,2S)-Tramadol hydrochloride
CAS:Please enquire for more information about (1R,2S)-Tramadol hydrochloride including the price, delivery time and more detailed product information at the technical inquiry form on this pageFormula:C16H26ClNO2Purity:Min. 95%Molecular weight:299.84 g/molTramadol Related Compound A CIV ((RS,SR)-1-(3-Methoxyphenyl)-2-(dimethylaminomethyl)cyclohexanol hydrochloride)
CAS:Controlled ProductAromatic amino-alcohol-phenols, aromatic amino-acid-phenols and other aromatic amino compounds with oxygen functionFormula:C16H25NO2·HClColor and Shape:White PowderMolecular weight:263.18853





